| Name | n-Hexadecylsuccinic anhydride |
| Synonyms | NSC 77137 HEXADECYL SUCCINIC ANHYDRIDE 3-hexadecyloxolane-2,5-dione n-Hexadecylsuccinic anhydride 2-Hexadecylsuccinic anhydride N-HEXADECYLSUCCINIC ANHYDRIDE 3-hexadecyldihydrofuran-2,5-dione 3-Hexadecyldihydrofuran-2,5-dione 3-cetyltetrahydrofuran-2,5-quinone Dihydro-3-hexadecyl-2,5-furandione 2,5-Furandione, 3-hexadecyldihydro- 3,4-Dihydro-3-hexadecyl-2,5-furandione |
| CAS | 4200-91-3 |
| EINECS | 224-101-6 |
| InChI | InChI=1/C20H36O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-17-19(21)23-20(18)22/h18H,2-17H2,1H3 |
| Molecular Formula | C20H36O3 |
| Molar Mass | 324.5 |
| Density | 0.950±0.06 g/cm3(Predicted) |
| Melting Point | 75°C |
| Boling Point | 442.7±14.0 °C(Predicted) |
| Flash Point | 199.6°C |
| Solubility | soluble in Benzene |
| Vapor Presure | 4.9E-08mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Almost white |
| Storage Condition | Room Temprature |
| Refractive Index | 1.465 |
| MDL | MFCD00014550 |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |